C34H34O13 — CID 162906321
(1R,2S,3R,4S,5R)-3,4-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-2-[(3-ethylphenyl)methyl]-1,4,5-trihydroxycyclohexane-1-carboxylic acid (PubChem CID 162906321) has the molecular formula C34H34O13 and a molecular weight of 650.63 g/mol. Its IUPAC name is (1R,2S,3R,4S,5R)-3,4-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-2-[(3-ethylphenyl)methyl]-1,4,5-trihydroxycyclohexane-1-carboxylic acid.
| Compound Name | (1R,2S,3R,4S,5R)-3,4-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-2-[(3-ethylphenyl)methyl]-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 162906321 |
| Molecular Formula | C34H34O13 |
| Molecular Weight | 650.63 g/mol |
| Exact Mass | 650.20 |
| IUPAC Name | (1R,2S,3R,4S,5R)-3,4-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-2-[(3-ethylphenyl)methyl]-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
| SMILES | CCc1cccc(C[C@H]2[C@@H](OC(=O)/C=C/c3ccc(O)c(O)c3)[C@@](O)(OC(=O)/C=C/c3ccc(O)c(O)c3)[C@H](O)C[C@]2(O)C(=O)O)c1 |
| InChI | InChI=1S/C34H34O13/c1-2-19-4-3-5-22(14-19)15-23-31(46-29(40)12-8-20-6-10-24(35)26(37)16-20)34(45,28(39)18-33(23,44)32(42)43)47-30(41)13-9-21-7-11-25(36)27(38)17-21/h3-14,16-17,23,28,31,35-39,44-45H,2,15,18H2,1H3,(H,42,43)/b12-8+,13-9+/t23-,28+,31+,33+,34-/m0/s1 |
| InChIKey | ABDUMHHBCXQEFO-UOZNLXJRSA-N |
| XLogP | 2.38 |
| TPSA | 231.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.63 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|