C34H35NO13 — CID 163102410
2-benzyl-3,4-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,5-dihydroxy-4-[hydroxy(methylamino)methyl]cyclohexane-1-carboxylic acid (PubChem CID 163102410) has the molecular formula C34H35NO13 and a molecular weight of 665.65 g/mol. Its IUPAC name is 2-benzyl-3,4-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,5-dihydroxy-4-[hydroxy(methylamino)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-benzyl-3,4-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,5-dihydroxy-4-[hydroxy(methylamino)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 163102410 |
| Molecular Formula | C34H35NO13 |
| Molecular Weight | 665.65 g/mol |
| Exact Mass | 665.21 |
| IUPAC Name | 2-benzyl-3,4-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,5-dihydroxy-4-[hydroxy(methylamino)methyl]cyclohexane-1-carboxylic acid |
| SMILES | CNC(O)C1(OC(=O)C=Cc2ccc(O)c(O)c2)C(O)CC(O)(C(=O)O)C(Cc2ccccc2)C1OC(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C34H35NO13/c1-35-31(43)34(48-29(42)14-10-21-8-12-24(37)26(39)17-21)27(40)18-33(46,32(44)45)22(15-19-5-3-2-4-6-19)30(34)47-28(41)13-9-20-7-11-23(36)25(38)16-20/h2-14,16-17,22,27,30-31,35-40,43,46H,15,18H2,1H3,(H,44,45) |
| InChIKey | LGWKRCUNLGVTRX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 243.54 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.65 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|