C38H41NO12 — CID 163100522
4a,5-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-6-[(3-ethylphenyl)methyl]-7-hydroxy-4-(methylamino)-3,4,5,6,8,8a-hexahydro-2H-chromene-7-carboxylic acid (PubChem CID 163100522) has the molecular formula C38H41NO12 and a molecular weight of 703.74 g/mol. Its IUPAC name is 4a,5-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-6-[(3-ethylphenyl)methyl]-7-hydroxy-4-(methylamino)-3,4,5,6,8,8a-hexahydro-2H-chromene-7-carboxylic acid.
| Compound Name | 4a,5-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-6-[(3-ethylphenyl)methyl]-7-hydroxy-4-(methylamino)-3,4,5,6,8,8a-hexahydro-2H-chromene-7-carboxylic acid |
|---|---|
| PubChem CID | 163100522 |
| Molecular Formula | C38H41NO12 |
| Molecular Weight | 703.74 g/mol |
| Exact Mass | 703.26 |
| IUPAC Name | 4a,5-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-6-[(3-ethylphenyl)methyl]-7-hydroxy-4-(methylamino)-3,4,5,6,8,8a-hexahydro-2H-chromene-7-carboxylic acid |
| SMILES | CCc1cccc(CC2C(OC(=O)C=Cc3ccc(O)c(O)c3)C3(OC(=O)C=Cc4ccc(O)c(O)c4)C(NC)CCOC3CC2(O)C(=O)O)c1 |
| InChI | InChI=1S/C38H41NO12/c1-3-22-5-4-6-25(17-22)18-26-35(50-33(44)13-9-23-7-11-27(40)29(42)19-23)38(51-34(45)14-10-24-8-12-28(41)30(43)20-24)31(39-2)15-16-49-32(38)21-37(26,48)36(46)47/h4-14,17,19-20,26,31-32,35,39-43,48H,3,15-16,18,21H2,1-2H3,(H,46,47) |
| InChIKey | DIFXYZHYIZYANN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 212.31 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.74 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|