C32H30O13 — CID 162891820
2-benzyl-3,4-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,4,5-trihydroxycyclohexane-1-carboxylic acid (PubChem CID 162891820) has the molecular formula C32H30O13 and a molecular weight of 622.58 g/mol. Its IUPAC name is 2-benzyl-3,4-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,4,5-trihydroxycyclohexane-1-carboxylic acid.
| Compound Name | 2-benzyl-3,4-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 162891820 |
| Molecular Formula | C32H30O13 |
| Molecular Weight | 622.58 g/mol |
| Exact Mass | 622.17 |
| IUPAC Name | 2-benzyl-3,4-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)OC1C(Cc2ccccc2)C(O)(C(=O)O)CC(O)C1(O)OC(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C32H30O13/c33-22-10-6-19(15-24(22)35)8-12-27(38)44-29-21(14-18-4-2-1-3-5-18)31(42,30(40)41)17-26(37)32(29,43)45-28(39)13-9-20-7-11-23(34)25(36)16-20/h1-13,15-16,21,26,29,33-37,42-43H,14,17H2,(H,40,41) |
| InChIKey | MXVSFVRBRFDEQZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 231.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.58 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|