C38H41NO13 — CID 162829847
4a,5-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-6-[(3-ethylphenyl)methyl]-4,7-dihydroxy-4-(methylamino)-2,3,5,6,8,8a-hexahydrochromene-7-carboxylic acid (PubChem CID 162829847) has the molecular formula C38H41NO13 and a molecular weight of 719.74 g/mol. Its IUPAC name is 4a,5-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-6-[(3-ethylphenyl)methyl]-4,7-dihydroxy-4-(methylamino)-2,3,5,6,8,8a-hexahydrochromene-7-carboxylic acid.
| Compound Name | 4a,5-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-6-[(3-ethylphenyl)methyl]-4,7-dihydroxy-4-(methylamino)-2,3,5,6,8,8a-hexahydrochromene-7-carboxylic acid |
|---|---|
| PubChem CID | 162829847 |
| Molecular Formula | C38H41NO13 |
| Molecular Weight | 719.74 g/mol |
| Exact Mass | 719.26 |
| IUPAC Name | 4a,5-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-6-[(3-ethylphenyl)methyl]-4,7-dihydroxy-4-(methylamino)-2,3,5,6,8,8a-hexahydrochromene-7-carboxylic acid |
| SMILES | CCc1cccc(CC2C(OC(=O)C=Cc3ccc(O)c(O)c3)C3(OC(=O)C=Cc4ccc(O)c(O)c4)C(CC2(O)C(=O)O)OCCC3(O)NC)c1 |
| InChI | InChI=1S/C38H41NO13/c1-3-22-5-4-6-25(17-22)18-26-34(51-32(44)13-9-23-7-11-27(40)29(42)19-23)38(52-33(45)14-10-24-8-12-28(41)30(43)20-24)31(21-36(26,48)35(46)47)50-16-15-37(38,49)39-2/h4-14,17,19-20,26,31,34,39-43,48-49H,3,15-16,18,21H2,1-2H3,(H,46,47) |
| InChIKey | HVNUIGYXHQVUEV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 232.54 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.74 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|