C18H25NO5 — CID 162910365
4,6,12-trimethoxy-9-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6-triene-5,15-diol (PubChem CID 162910365) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 4,6,12-trimethoxy-9-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6-triene-5,15-diol.
| Compound Name | 4,6,12-trimethoxy-9-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6-triene-5,15-diol |
|---|---|
| PubChem CID | 162910365 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 4,6,12-trimethoxy-9-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6-triene-5,15-diol |
| SMILES | COc1cc2c(c(OC)c1O)CN1CC(O)C23CCC(OC)CC13 |
| InChI | InChI=1S/C18H25NO5/c1-22-10-4-5-18-12-7-13(23-2)16(21)17(24-3)11(12)8-19(9-15(18)20)14(18)6-10/h7,10,14-15,20-21H,4-6,8-9H2,1-3H3 |
| InChIKey | RRUFHULZICOXGJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |