C21H24O5 — CID 162928973
4-[(2S)-8-(4-hydroxy-3-methylbut-2-enyl)-7-methoxy-3,4-dihydro-2H-chromen-2-yl]benzene-1,3-diol (PubChem CID 162928973) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is 4-[(2S)-8-(4-hydroxy-3-methylbut-2-enyl)-7-methoxy-3,4-dihydro-2H-chromen-2-yl]benzene-1,3-diol.
| Compound Name | 4-[(2S)-8-(4-hydroxy-3-methylbut-2-enyl)-7-methoxy-3,4-dihydro-2H-chromen-2-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 162928973 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 4-[(2S)-8-(4-hydroxy-3-methylbut-2-enyl)-7-methoxy-3,4-dihydro-2H-chromen-2-yl]benzene-1,3-diol |
| SMILES | COc1ccc2c(c1CC=C(C)CO)O[C@H](c1ccc(O)cc1O)CC2 |
| InChI | InChI=1S/C21H24O5/c1-13(12-22)3-7-17-19(25-2)9-4-14-5-10-20(26-21(14)17)16-8-6-15(23)11-18(16)24/h3-4,6,8-9,11,20,22-24H,5,7,10,12H2,1-2H3/t20-/m0/s1 |
| InChIKey | ZWYKFLRPPQSGJI-FQEVSTJZSA-N |
| XLogP | 3.65 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|