C15H22O5 — CID 10493154
(E)-2-methyl-4-(2,3,5,6-tetramethoxyphenyl)but-2-en-1-ol (PubChem CID 10493154) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is (E)-2-methyl-4-(2,3,5,6-tetramethoxyphenyl)but-2-en-1-ol.
| Compound Name | (E)-2-methyl-4-(2,3,5,6-tetramethoxyphenyl)but-2-en-1-ol |
|---|---|
| PubChem CID | 10493154 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (E)-2-methyl-4-(2,3,5,6-tetramethoxyphenyl)but-2-en-1-ol |
| SMILES | COc1cc(OC)c(OC)c(C/C=C(\C)CO)c1OC |
| InChI | InChI=1S/C15H22O5/c1-10(9-16)6-7-11-14(19-4)12(17-2)8-13(18-3)15(11)20-5/h6,8,16H,7,9H2,1-5H3/b10-6+ |
| InChIKey | UYPQFCHWSIYBSB-UXBLZVDNSA-N |
| XLogP | 2.20 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|