C31H53NO6 — CID 162930620
[(3S,4R,6S,9R,10R,13E,16R,18S)-4,10-dihydroxy-3,6,16-trimethyl-18-[(1E,3E)-2-methylnona-1,3-dienyl]-2-oxo-1-oxacyclooctadec-13-en-9-yl] carbamate (PubChem CID 162930620) has the molecular formula C31H53NO6 and a molecular weight of 535.77 g/mol. Its IUPAC name is [(3S,4R,6S,9R,10R,13E,16R,18S)-4,10-dihydroxy-3,6,16-trimethyl-18-[(1E,3E)-2-methylnona-1,3-dienyl]-2-oxo-1-oxacyclooctadec-13-en-9-yl] carbamate.
| Compound Name | [(3S,4R,6S,9R,10R,13E,16R,18S)-4,10-dihydroxy-3,6,16-trimethyl-18-[(1E,3E)-2-methylnona-1,3-dienyl]-2-oxo-1-oxacyclooctadec-13-en-9-yl] carbamate |
|---|---|
| PubChem CID | 162930620 |
| Molecular Formula | C31H53NO6 |
| Molecular Weight | 535.77 g/mol |
| Exact Mass | 535.39 |
| IUPAC Name | [(3S,4R,6S,9R,10R,13E,16R,18S)-4,10-dihydroxy-3,6,16-trimethyl-18-[(1E,3E)-2-methylnona-1,3-dienyl]-2-oxo-1-oxacyclooctadec-13-en-9-yl] carbamate |
| SMILES | CCCCC/C=C/C(C)=C/[C@@H]1C[C@H](C)C/C=C/CC[C@@H](O)[C@H](OC(N)=O)CC[C@H](C)C[C@@H](O)[C@H](C)C(=O)O1 |
| InChI | InChI=1S/C31H53NO6/c1-6-7-8-9-11-14-22(2)19-26-20-23(3)15-12-10-13-16-27(33)29(38-31(32)36)18-17-24(4)21-28(34)25(5)30(35)37-26/h10-12,14,19,23-29,33-34H,6-9,13,15-18,20-21H2,1-5H3,(H2,32,36)/b12-10+,14-11+,22-19+/t23-,24+,25+,26-,27-,28-,29-/m1/s1 |
| InChIKey | IKWWLIZHWPWWDY-VEZUYBLQSA-N |
| XLogP | 6.38 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.77 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|