C33H54O7 — CID 59614497
[(13E)-10-formyloxy-4-hydroxy-3,6,16-trimethyl-18-[(1E,3Z)-2-methylnona-1,3-dienyl]-2-oxo-1-oxacyclooctadec-13-en-9-yl] acetate (PubChem CID 59614497) has the molecular formula C33H54O7 and a molecular weight of 562.79 g/mol. Its IUPAC name is [(13E)-10-formyloxy-4-hydroxy-3,6,16-trimethyl-18-[(1E,3Z)-2-methylnona-1,3-dienyl]-2-oxo-1-oxacyclooctadec-13-en-9-yl] acetate.
| Compound Name | [(13E)-10-formyloxy-4-hydroxy-3,6,16-trimethyl-18-[(1E,3Z)-2-methylnona-1,3-dienyl]-2-oxo-1-oxacyclooctadec-13-en-9-yl] acetate |
|---|---|
| PubChem CID | 59614497 |
| Molecular Formula | C33H54O7 |
| Molecular Weight | 562.79 g/mol |
| Exact Mass | 562.39 |
| IUPAC Name | [(13E)-10-formyloxy-4-hydroxy-3,6,16-trimethyl-18-[(1E,3Z)-2-methylnona-1,3-dienyl]-2-oxo-1-oxacyclooctadec-13-en-9-yl] acetate |
| SMILES | CCCCC/C=C\C(C)=C\C1CC(C)C/C=C/CCC(OC=O)C(OC(C)=O)CCC(C)CC(O)C(C)C(=O)O1 |
| InChI | InChI=1S/C33H54O7/c1-7-8-9-10-12-15-24(2)20-29-21-25(3)16-13-11-14-17-31(38-23-34)32(39-28(6)35)19-18-26(4)22-30(36)27(5)33(37)40-29/h11-13,15,20,23,25-27,29-32,36H,7-10,14,16-19,21-22H2,1-6H3/b13-11+,15-12-,24-20+ |
| InChIKey | LQQBDLDLTCNIIV-BGYQTBBPSA-N |
| XLogP | 7.02 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.79 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|