C32H54N2O7 — CID 162937965
[(3S,4S,6R,9R,10R,16R,18S)-4-carbamoyloxy-10-hydroxy-3,6,16-trimethyl-18-(2-methylnona-1,3-dienyl)-2-oxo-1-oxacyclooctadec-13-en-9-yl] carbamate (PubChem CID 162937965) has the molecular formula C32H54N2O7 and a molecular weight of 578.79 g/mol. Its IUPAC name is [(3S,4S,6R,9R,10R,16R,18S)-4-carbamoyloxy-10-hydroxy-3,6,16-trimethyl-18-(2-methylnona-1,3-dienyl)-2-oxo-1-oxacyclooctadec-13-en-9-yl] carbamate.
| Compound Name | [(3S,4S,6R,9R,10R,16R,18S)-4-carbamoyloxy-10-hydroxy-3,6,16-trimethyl-18-(2-methylnona-1,3-dienyl)-2-oxo-1-oxacyclooctadec-13-en-9-yl] carbamate |
|---|---|
| PubChem CID | 162937965 |
| Molecular Formula | C32H54N2O7 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.39 |
| IUPAC Name | [(3S,4S,6R,9R,10R,16R,18S)-4-carbamoyloxy-10-hydroxy-3,6,16-trimethyl-18-(2-methylnona-1,3-dienyl)-2-oxo-1-oxacyclooctadec-13-en-9-yl] carbamate |
| SMILES | CCCCCC=CC(C)=C[C@@H]1C[C@H](C)CC=CCC[C@@H](O)[C@H](OC(N)=O)CC[C@@H](C)C[C@H](OC(N)=O)[C@H](C)C(=O)O1 |
| InChI | InChI=1S/C32H54N2O7/c1-6-7-8-9-11-14-22(2)19-26-20-23(3)15-12-10-13-16-27(35)28(40-31(33)37)18-17-24(4)21-29(41-32(34)38)25(5)30(36)39-26/h10-12,14,19,23-29,35H,6-9,13,15-18,20-21H2,1-5H3,(H2,33,37)(H2,34,38)/t23-,24-,25+,26-,27-,28-,29+/m1/s1 |
| InChIKey | LVJVVBKSVCMFFS-SPKCQJGSSA-N |
| XLogP | 6.48 |
| TPSA | 151.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|