C30H29N3O12 — CID 162936936
6-[3-benzyl-5,6-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4-[(diaminomethylideneamino)methyl]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 162936936) has the molecular formula C30H29N3O12 and a molecular weight of 623.57 g/mol. Its IUPAC name is 6-[3-benzyl-5,6-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4-[(diaminomethylideneamino)methyl]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[3-benzyl-5,6-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4-[(diaminomethylideneamino)methyl]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 162936936 |
| Molecular Formula | C30H29N3O12 |
| Molecular Weight | 623.57 g/mol |
| Exact Mass | 623.18 |
| IUPAC Name | 6-[3-benzyl-5,6-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4-[(diaminomethylideneamino)methyl]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | NC(N)=NCC1(O)C(O)C(Oc2cc3oc(-c4ccc(O)cc4)c(Cc4ccccc4)c(=O)c3c(O)c2O)OC(C(=O)O)C1O |
| InChI | InChI=1S/C30H29N3O12/c31-29(32)33-12-30(42)25(38)24(27(40)41)45-28(26(30)39)44-18-11-17-19(22(37)21(18)36)20(35)16(10-13-4-2-1-3-5-13)23(43-17)14-6-8-15(34)9-7-14/h1-9,11,24-26,28,34,36-39,42H,10,12H2,(H,40,41)(H4,31,32,33) |
| InChIKey | BZZRXXXARHXLMH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 271.75 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.57 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|