C16H28N2O — CID 162940072
[(1R,2R,8R,9S,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-8-yl]methanol (PubChem CID 162940072) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is [(1R,2R,8R,9S,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-8-yl]methanol.
| Compound Name | [(1R,2R,8R,9S,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-8-yl]methanol |
|---|---|
| PubChem CID | 162940072 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | [(1R,2R,8R,9S,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-8-yl]methanol |
| SMILES | OC[C@H]1[C@H]2C[C@H](CN3CCCC[C@@H]23)[C@H]2CCCCN21 |
| InChI | InChI=1S/C16H28N2O/c19-11-16-13-9-12(14-5-2-4-8-18(14)16)10-17-7-3-1-6-15(13)17/h12-16,19H,1-11H2/t12-,13+,14-,15+,16+/m1/s1 |
| InChIKey | ARXKUSWEPIURJP-LEOABGAYSA-N |
| XLogP | 1.71 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |