C20H26O6 — CID 162945030
(1S,2S,5R,9R,12R,13S,18R)-13-hydroxy-5-(2-hydroxyacetyl)-5,12-dimethyl-10,14-dioxapentacyclo[11.2.2.11,9.02,7.012,18]octadec-7-en-11-one (PubChem CID 162945030) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is (1S,2S,5R,9R,12R,13S,18R)-13-hydroxy-5-(2-hydroxyacetyl)-5,12-dimethyl-10,14-dioxapentacyclo[11.2.2.11,9.02,7.012,18]octadec-7-en-11-one.
| Compound Name | (1S,2S,5R,9R,12R,13S,18R)-13-hydroxy-5-(2-hydroxyacetyl)-5,12-dimethyl-10,14-dioxapentacyclo[11.2.2.11,9.02,7.012,18]octadec-7-en-11-one |
|---|---|
| PubChem CID | 162945030 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (1S,2S,5R,9R,12R,13S,18R)-13-hydroxy-5-(2-hydroxyacetyl)-5,12-dimethyl-10,14-dioxapentacyclo[11.2.2.11,9.02,7.012,18]octadec-7-en-11-one |
| SMILES | C[C@@]1(C(=O)CO)CC[C@H]2C(=C[C@H]3OC(=O)[C@]4(C)[C@H]3[C@]23CC[C@]4(O)OC3)C1 |
| InChI | InChI=1S/C20H26O6/c1-17(14(22)9-21)4-3-12-11(8-17)7-13-15-18(2,16(23)26-13)20(24)6-5-19(12,15)10-25-20/h7,12-13,15,21,24H,3-6,8-10H2,1-2H3/t12-,13+,15-,17+,18-,19-,20-/m0/s1 |
| InChIKey | YKOCFEFYIFARIO-GEWSPJPLSA-N |
| XLogP | 1.34 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|