C24H42O12 — CID 162954727
(2S,3R,4S,5S,6R)-2-[(1S,2R)-2-hydroxy-4-[(3R)-3-hydroxybutyl]-3,5,5-trimethylcyclohex-3-en-1-yl]oxy-6-[[(2R,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol (PubChem CID 162954727) has the molecular formula C24H42O12 and a molecular weight of 522.59 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[(1S,2R)-2-hydroxy-4-[(3R)-3-hydroxybutyl]-3,5,5-trimethylcyclohex-3-en-1-yl]oxy-6-[[(2R,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[(1S,2R)-2-hydroxy-4-[(3R)-3-hydroxybutyl]-3,5,5-trimethylcyclohex-3-en-1-yl]oxy-6-[[(2R,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162954727 |
| Molecular Formula | C24H42O12 |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[(1S,2R)-2-hydroxy-4-[(3R)-3-hydroxybutyl]-3,5,5-trimethylcyclohex-3-en-1-yl]oxy-6-[[(2R,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol |
| SMILES | CC1=C(CC[C@@H](C)O)C(C)(C)C[C@H](O[C@H]2O[C@H](CO[C@H]3OC[C@H](O)[C@@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O |
| InChI | InChI=1S/C24H42O12/c1-10(25)5-6-12-11(2)16(27)14(7-24(12,3)4)35-23-21(32)19(30)18(29)15(36-23)9-34-22-20(31)17(28)13(26)8-33-22/h10,13-23,25-32H,5-9H2,1-4H3/t10-,13+,14+,15-,16-,17-,18-,19+,20-,21-,22-,23+/m1/s1 |
| InChIKey | MHTNCTLSGFGCDJ-FWWZJAALSA-N |
| XLogP | -2.10 |
| TPSA | 198.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|