C21H30O6 — CID 162955712
[(1S,2S,3R)-3-[(2E,4E)-6-hydroperoxy-6-methylhepta-2,4-dien-2-yl]-1-hydroxy-2-[(1S,2R)-2-methyl-5-oxocyclopent-3-en-1-yl]cyclopentyl] acetate (PubChem CID 162955712) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is [(1S,2S,3R)-3-[(2E,4E)-6-hydroperoxy-6-methylhepta-2,4-dien-2-yl]-1-hydroxy-2-[(1S,2R)-2-methyl-5-oxocyclopent-3-en-1-yl]cyclopentyl] acetate.
| Compound Name | [(1S,2S,3R)-3-[(2E,4E)-6-hydroperoxy-6-methylhepta-2,4-dien-2-yl]-1-hydroxy-2-[(1S,2R)-2-methyl-5-oxocyclopent-3-en-1-yl]cyclopentyl] acetate |
|---|---|
| PubChem CID | 162955712 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [(1S,2S,3R)-3-[(2E,4E)-6-hydroperoxy-6-methylhepta-2,4-dien-2-yl]-1-hydroxy-2-[(1S,2R)-2-methyl-5-oxocyclopent-3-en-1-yl]cyclopentyl] acetate |
| SMILES | CC(=O)O[C@@]1(O)CC[C@@H](/C(C)=C/C=C/C(C)(C)OO)[C@H]1[C@H]1C(=O)C=C[C@H]1C |
| InChI | InChI=1S/C21H30O6/c1-13(7-6-11-20(4,5)27-25)16-10-12-21(24,26-15(3)22)19(16)18-14(2)8-9-17(18)23/h6-9,11,14,16,18-19,24-25H,10,12H2,1-5H3/b11-6+,13-7+/t14-,16+,18-,19+,21+/m1/s1 |
| InChIKey | SMHGBAYGYMMHKI-PAWGUKEYSA-N |
| XLogP | 3.43 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|