C22H12O13 — CID 162967250
3,4,5-trihydroxy-2-[(7,13,14-trihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-6-yl)oxymethyl]benzoic acid (PubChem CID 162967250) has the molecular formula C22H12O13 and a molecular weight of 484.33 g/mol. Its IUPAC name is 3,4,5-trihydroxy-2-[(7,13,14-trihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-6-yl)oxymethyl]benzoic acid.
| Compound Name | 3,4,5-trihydroxy-2-[(7,13,14-trihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-6-yl)oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 162967250 |
| Molecular Formula | C22H12O13 |
| Molecular Weight | 484.33 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | 3,4,5-trihydroxy-2-[(7,13,14-trihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-6-yl)oxymethyl]benzoic acid |
| SMILES | O=C(O)c1cc(O)c(O)c(O)c1COc1cc2c(=O)oc3c(O)c(O)cc4c(=O)oc(c1O)c2c34 |
| InChI | InChI=1S/C22H12O13/c23-9-1-5(20(29)30)8(14(25)15(9)26)4-33-11-3-7-13-12-6(21(31)35-19(13)17(11)28)2-10(24)16(27)18(12)34-22(7)32/h1-3,23-28H,4H2,(H,29,30) |
| InChIKey | QCQXPORCTOCKGN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 228.33 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|