C24H36O11 — CID 162994044
(2-acetyloxy-1,5,7,10,11-pentahydroxy-4,12,12,15-tetramethyl-8-methylidene-14-oxo-16-oxatricyclo[11.2.1.02,6]hexadecan-9-yl) acetate (PubChem CID 162994044) has the molecular formula C24H36O11 and a molecular weight of 500.54 g/mol. Its IUPAC name is (2-acetyloxy-1,5,7,10,11-pentahydroxy-4,12,12,15-tetramethyl-8-methylidene-14-oxo-16-oxatricyclo[11.2.1.02,6]hexadecan-9-yl) acetate.
| Compound Name | (2-acetyloxy-1,5,7,10,11-pentahydroxy-4,12,12,15-tetramethyl-8-methylidene-14-oxo-16-oxatricyclo[11.2.1.02,6]hexadecan-9-yl) acetate |
|---|---|
| PubChem CID | 162994044 |
| Molecular Formula | C24H36O11 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (2-acetyloxy-1,5,7,10,11-pentahydroxy-4,12,12,15-tetramethyl-8-methylidene-14-oxo-16-oxatricyclo[11.2.1.02,6]hexadecan-9-yl) acetate |
| SMILES | C=C1C(O)C2C(O)C(C)CC2(OC(C)=O)C2(O)OC(C(=O)C2C)C(C)(C)C(O)C(O)C1OC(C)=O |
| InChI | InChI=1S/C24H36O11/c1-9-8-23(34-13(5)26)14(15(9)27)16(28)10(2)19(33-12(4)25)18(30)20(31)22(6,7)21-17(29)11(3)24(23,32)35-21/h9,11,14-16,18-21,27-28,30-32H,2,8H2,1,3-7H3 |
| InChIKey | QCCPFILGSBBQDJ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|