C26H30O9 — CID 163002790
(1S,2R,6R,7R,10R,11S,16S,19R,20R)-6-(furan-3-yl)-19,20-dihydroxy-7,17,17-trimethyl-5,13,21-trioxahexacyclo[17.2.1.01,10.02,7.011,16.011,20]docosane-4,14,18-trione (PubChem CID 163002790) has the molecular formula C26H30O9 and a molecular weight of 486.52 g/mol. Its IUPAC name is (1S,2R,6R,7R,10R,11S,16S,19R,20R)-6-(furan-3-yl)-19,20-dihydroxy-7,17,17-trimethyl-5,13,21-trioxahexacyclo[17.2.1.01,10.02,7.011,16.011,20]docosane-4,14,18-trione.
| Compound Name | (1S,2R,6R,7R,10R,11S,16S,19R,20R)-6-(furan-3-yl)-19,20-dihydroxy-7,17,17-trimethyl-5,13,21-trioxahexacyclo[17.2.1.01,10.02,7.011,16.011,20]docosane-4,14,18-trione |
|---|---|
| PubChem CID | 163002790 |
| Molecular Formula | C26H30O9 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | (1S,2R,6R,7R,10R,11S,16S,19R,20R)-6-(furan-3-yl)-19,20-dihydroxy-7,17,17-trimethyl-5,13,21-trioxahexacyclo[17.2.1.01,10.02,7.011,16.011,20]docosane-4,14,18-trione |
| SMILES | CC1(C)C(=O)[C@]2(O)C[C@@]34O[C@]2(O)[C@]2(COC(=O)C[C@@H]12)[C@H]3CC[C@]1(C)[C@H]4CC(=O)O[C@H]1c1ccoc1 |
| InChI | InChI=1S/C26H30O9/c1-21(2)15-8-17(27)33-12-23(15)14-4-6-22(3)16(9-18(28)34-19(22)13-5-7-32-10-13)24(14)11-25(30,20(21)29)26(23,31)35-24/h5,7,10,14-16,19,30-31H,4,6,8-9,11-12H2,1-3H3/t14-,15+,16-,19+,22-,23-,24-,25-,26-/m1/s1 |
| InChIKey | KZFPZDFHHOUZCZ-WDGQYQOASA-N |
| XLogP | 2.05 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |