C29H46N2O6 — CID 163013675
6-benzyl-3-butan-2-yl-10-hydroxy-12-(6-hydroxyheptyl)-4,9-dimethyl-1-oxa-4,7-diazacyclododecane-2,5,8-trione (PubChem CID 163013675) has the molecular formula C29H46N2O6 and a molecular weight of 518.70 g/mol. Its IUPAC name is 6-benzyl-3-butan-2-yl-10-hydroxy-12-(6-hydroxyheptyl)-4,9-dimethyl-1-oxa-4,7-diazacyclododecane-2,5,8-trione.
| Compound Name | 6-benzyl-3-butan-2-yl-10-hydroxy-12-(6-hydroxyheptyl)-4,9-dimethyl-1-oxa-4,7-diazacyclododecane-2,5,8-trione |
|---|---|
| PubChem CID | 163013675 |
| Molecular Formula | C29H46N2O6 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | 6-benzyl-3-butan-2-yl-10-hydroxy-12-(6-hydroxyheptyl)-4,9-dimethyl-1-oxa-4,7-diazacyclododecane-2,5,8-trione |
| SMILES | CCC(C)C1C(=O)OC(CCCCCC(C)O)CC(O)C(C)C(=O)NC(Cc2ccccc2)C(=O)N1C |
| InChI | InChI=1S/C29H46N2O6/c1-6-19(2)26-29(36)37-23(16-12-7-9-13-20(3)32)18-25(33)21(4)27(34)30-24(28(35)31(26)5)17-22-14-10-8-11-15-22/h8,10-11,14-15,19-21,23-26,32-33H,6-7,9,12-13,16-18H2,1-5H3,(H,30,34) |
| InChIKey | FYFLUENRPAAKQH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|