C35H56N2O11 — CID 163135002
6-benzyl-3-butan-2-yl-10-hydroxy-4-methyl-12-[7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctan-2-yl]-1-oxa-4,7-diazacyclododecane-2,5,8-trione (PubChem CID 163135002) has the molecular formula C35H56N2O11 and a molecular weight of 680.84 g/mol. Its IUPAC name is 6-benzyl-3-butan-2-yl-10-hydroxy-4-methyl-12-[7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctan-2-yl]-1-oxa-4,7-diazacyclododecane-2,5,8-trione.
| Compound Name | 6-benzyl-3-butan-2-yl-10-hydroxy-4-methyl-12-[7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctan-2-yl]-1-oxa-4,7-diazacyclododecane-2,5,8-trione |
|---|---|
| PubChem CID | 163135002 |
| Molecular Formula | C35H56N2O11 |
| Molecular Weight | 680.84 g/mol |
| Exact Mass | 680.39 |
| IUPAC Name | 6-benzyl-3-butan-2-yl-10-hydroxy-4-methyl-12-[7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctan-2-yl]-1-oxa-4,7-diazacyclododecane-2,5,8-trione |
| SMILES | CCC(C)C1C(=O)OC(C(C)CCCCC(C)OC2OC(CO)C(O)C(O)C2O)CC(O)CC(=O)NC(Cc2ccccc2)C(=O)N1C |
| InChI | InChI=1S/C35H56N2O11/c1-6-20(2)29-34(45)47-26(17-24(39)18-28(40)36-25(33(44)37(29)5)16-23-14-8-7-9-15-23)21(3)12-10-11-13-22(4)46-35-32(43)31(42)30(41)27(19-38)48-35/h7-9,14-15,20-22,24-27,29-32,35,38-39,41-43H,6,10-13,16-19H2,1-5H3,(H,36,40) |
| InChIKey | HPPUILYZIHIGQH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 195.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.84 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|