C17H9ClO6 — CID 163015811
(4R,8S)-17-chloro-2,18-dihydroxy-7,9,13-trioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1,3(10),5,11,14(19),15,17-heptaen-20-one (PubChem CID 163015811) has the molecular formula C17H9ClO6 and a molecular weight of 344.71 g/mol. Its IUPAC name is (4R,8S)-17-chloro-2,18-dihydroxy-7,9,13-trioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1,3(10),5,11,14(19),15,17-heptaen-20-one.
| Compound Name | (4R,8S)-17-chloro-2,18-dihydroxy-7,9,13-trioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1,3(10),5,11,14(19),15,17-heptaen-20-one |
|---|---|
| PubChem CID | 163015811 |
| Molecular Formula | C17H9ClO6 |
| Molecular Weight | 344.71 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | (4R,8S)-17-chloro-2,18-dihydroxy-7,9,13-trioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1,3(10),5,11,14(19),15,17-heptaen-20-one |
| SMILES | O=c1c2c(O)c(Cl)ccc2oc2cc3c(c(O)c12)[C@H]1C=CO[C@H]1O3 |
| InChI | InChI=1S/C17H9ClO6/c18-7-1-2-8-12(14(7)19)16(21)13-10(23-8)5-9-11(15(13)20)6-3-4-22-17(6)24-9/h1-6,17,19-20H/t6-,17+/m1/s1 |
| InChIKey | HDKZHQZTULHWBG-DDNLTXGXSA-N |
| XLogP | 3.36 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.71 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|