C24H28O6 — CID 163023247
16-(3-hydroperoxy-3-methylbut-1-enyl)-11,11,15-trimethyl-6,10,19-trioxapentacyclo[13.3.1.02,7.09,18.012,17]nonadeca-1,3,7,9(18)-tetraen-5-one (PubChem CID 163023247) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is 16-(3-hydroperoxy-3-methylbut-1-enyl)-11,11,15-trimethyl-6,10,19-trioxapentacyclo[13.3.1.02,7.09,18.012,17]nonadeca-1,3,7,9(18)-tetraen-5-one.
| Compound Name | 16-(3-hydroperoxy-3-methylbut-1-enyl)-11,11,15-trimethyl-6,10,19-trioxapentacyclo[13.3.1.02,7.09,18.012,17]nonadeca-1,3,7,9(18)-tetraen-5-one |
|---|---|
| PubChem CID | 163023247 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 16-(3-hydroperoxy-3-methylbut-1-enyl)-11,11,15-trimethyl-6,10,19-trioxapentacyclo[13.3.1.02,7.09,18.012,17]nonadeca-1,3,7,9(18)-tetraen-5-one |
| SMILES | CC(C)(C=CC1C2c3c4cc5oc(=O)ccc5c3OC1(C)CCC2C(C)(C)O4)OO |
| InChI | InChI=1S/C24H28O6/c1-22(2,30-26)10-8-15-19-14-9-11-24(15,5)29-21-13-6-7-18(25)27-16(13)12-17(20(19)21)28-23(14,3)4/h6-8,10,12,14-15,19,26H,9,11H2,1-5H3 |
| InChIKey | ZPVBIQWUZYXRCN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|