C24H26O5 — CID 162847035
11,11,15-trimethyl-16-(3-methylbut-2-enoyl)-6,10,19-trioxapentacyclo[13.3.1.02,7.09,18.012,17]nonadeca-1,3,7,9(18)-tetraen-5-one (PubChem CID 162847035) has the molecular formula C24H26O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is 11,11,15-trimethyl-16-(3-methylbut-2-enoyl)-6,10,19-trioxapentacyclo[13.3.1.02,7.09,18.012,17]nonadeca-1,3,7,9(18)-tetraen-5-one.
| Compound Name | 11,11,15-trimethyl-16-(3-methylbut-2-enoyl)-6,10,19-trioxapentacyclo[13.3.1.02,7.09,18.012,17]nonadeca-1,3,7,9(18)-tetraen-5-one |
|---|---|
| PubChem CID | 162847035 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 11,11,15-trimethyl-16-(3-methylbut-2-enoyl)-6,10,19-trioxapentacyclo[13.3.1.02,7.09,18.012,17]nonadeca-1,3,7,9(18)-tetraen-5-one |
| SMILES | CC(C)=CC(=O)C1C2c3c4cc5oc(=O)ccc5c3OC1(C)CCC2C(C)(C)O4 |
| InChI | InChI=1S/C24H26O5/c1-12(2)10-15(25)21-19-14-8-9-24(21,5)29-22-13-6-7-18(26)27-16(13)11-17(20(19)22)28-23(14,3)4/h6-7,10-11,14,19,21H,8-9H2,1-5H3 |
| InChIKey | HUYZADBSQJFAIK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|