C24H36O6 — CID 163029061
[(2R,3S,5S,7R)-2-[[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-7-acetyloxy-1,6-dioxaspiro[2.4]heptan-5-yl] acetate (PubChem CID 163029061) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is [(2R,3S,5S,7R)-2-[[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-7-acetyloxy-1,6-dioxaspiro[2.4]heptan-5-yl] acetate.
| Compound Name | [(2R,3S,5S,7R)-2-[[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-7-acetyloxy-1,6-dioxaspiro[2.4]heptan-5-yl] acetate |
|---|---|
| PubChem CID | 163029061 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | [(2R,3S,5S,7R)-2-[[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-7-acetyloxy-1,6-dioxaspiro[2.4]heptan-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@]2(O[C@@H]2C[C@@]2(C)[C@H](C)CC[C@@]3(C)C(C)=CCC[C@H]23)[C@@H](OC(C)=O)O1 |
| InChI | InChI=1S/C24H36O6/c1-14-8-7-9-18-22(14,5)11-10-15(2)23(18,6)12-19-24(30-19)13-20(27-16(3)25)29-21(24)28-17(4)26/h8,15,18-21H,7,9-13H2,1-6H3/t15-,18+,19-,20-,21+,22+,23+,24+/m1/s1 |
| InChIKey | VSKPHEXLWDZWKU-RBTSZJRLSA-N |
| XLogP | 4.51 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|