C28H40O11 — CID 163037168
[(1R,2R,3R,5S,7S,8S,9R,10S,11S)-2,9,13-triacetyloxy-5,10,11-trihydroxy-8,12,15,15-tetramethyl-4-methylidene-7-tricyclo[9.3.1.03,8]pentadec-12-enyl] acetate (PubChem CID 163037168) has the molecular formula C28H40O11 and a molecular weight of 552.62 g/mol. Its IUPAC name is [(1R,2R,3R,5S,7S,8S,9R,10S,11S)-2,9,13-triacetyloxy-5,10,11-trihydroxy-8,12,15,15-tetramethyl-4-methylidene-7-tricyclo[9.3.1.03,8]pentadec-12-enyl] acetate.
| Compound Name | [(1R,2R,3R,5S,7S,8S,9R,10S,11S)-2,9,13-triacetyloxy-5,10,11-trihydroxy-8,12,15,15-tetramethyl-4-methylidene-7-tricyclo[9.3.1.03,8]pentadec-12-enyl] acetate |
|---|---|
| PubChem CID | 163037168 |
| Molecular Formula | C28H40O11 |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | [(1R,2R,3R,5S,7S,8S,9R,10S,11S)-2,9,13-triacetyloxy-5,10,11-trihydroxy-8,12,15,15-tetramethyl-4-methylidene-7-tricyclo[9.3.1.03,8]pentadec-12-enyl] acetate |
| SMILES | C=C1[C@@H](O)C[C@H](OC(C)=O)[C@@]2(C)[C@@H](OC(C)=O)[C@H](O)[C@@]3(O)C(C)=C(OC(C)=O)C[C@@H]([C@@H](OC(C)=O)[C@H]12)C3(C)C |
| InChI | InChI=1S/C28H40O11/c1-12-19(33)11-21(37-15(4)30)27(9)22(12)23(38-16(5)31)18-10-20(36-14(3)29)13(2)28(35,26(18,7)8)24(34)25(27)39-17(6)32/h18-19,21-25,33-35H,1,10-11H2,2-9H3/t18-,19-,21-,22-,23+,24-,25-,27+,28-/m0/s1 |
| InChIKey | LOEQAIIXDSNYRZ-KSWUFBNFSA-N |
| XLogP | 1.71 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|