C16H18O8 — CID 163039511
(3R,4aS,10aS)-3,6-dihydroxy-3,7,9-trimethoxy-1,4,4a,10a-tetrahydrobenzo[g]isochromene-5,10-dione (PubChem CID 163039511) has the molecular formula C16H18O8 and a molecular weight of 338.31 g/mol. Its IUPAC name is (3R,4aS,10aS)-3,6-dihydroxy-3,7,9-trimethoxy-1,4,4a,10a-tetrahydrobenzo[g]isochromene-5,10-dione.
| Compound Name | (3R,4aS,10aS)-3,6-dihydroxy-3,7,9-trimethoxy-1,4,4a,10a-tetrahydrobenzo[g]isochromene-5,10-dione |
|---|---|
| PubChem CID | 163039511 |
| Molecular Formula | C16H18O8 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (3R,4aS,10aS)-3,6-dihydroxy-3,7,9-trimethoxy-1,4,4a,10a-tetrahydrobenzo[g]isochromene-5,10-dione |
| SMILES | COc1cc(OC)c2c(c1O)C(=O)[C@H]1C[C@@](O)(OC)OC[C@H]1C2=O |
| InChI | InChI=1S/C16H18O8/c1-21-9-4-10(22-2)15(19)12-11(9)14(18)8-6-24-16(20,23-3)5-7(8)13(12)17/h4,7-8,19-20H,5-6H2,1-3H3/t7-,8+,16+/m0/s1 |
| InChIKey | CMNSGXGAENGZDE-BVEWNFNHSA-N |
| XLogP | 0.73 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|