C25H26O6 — CID 163043454
(8aS,12aR)-2-(3,4-dihydroxyphenyl)-5-hydroxy-12,12-dimethyl-8a,9,10,11,12a,13-hexahydro-8H-chromeno[7,8-c][2]benzoxepin-4-one (PubChem CID 163043454) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is (8aS,12aR)-2-(3,4-dihydroxyphenyl)-5-hydroxy-12,12-dimethyl-8a,9,10,11,12a,13-hexahydro-8H-chromeno[7,8-c][2]benzoxepin-4-one.
| Compound Name | (8aS,12aR)-2-(3,4-dihydroxyphenyl)-5-hydroxy-12,12-dimethyl-8a,9,10,11,12a,13-hexahydro-8H-chromeno[7,8-c][2]benzoxepin-4-one |
|---|---|
| PubChem CID | 163043454 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (8aS,12aR)-2-(3,4-dihydroxyphenyl)-5-hydroxy-12,12-dimethyl-8a,9,10,11,12a,13-hexahydro-8H-chromeno[7,8-c][2]benzoxepin-4-one |
| SMILES | CC1(C)CCC[C@@H]2COc3cc(O)c4c(=O)cc(-c5ccc(O)c(O)c5)oc4c3C[C@H]21 |
| InChI | InChI=1S/C25H26O6/c1-25(2)7-3-4-14-12-30-22-11-20(29)23-19(28)10-21(13-5-6-17(26)18(27)8-13)31-24(23)15(22)9-16(14)25/h5-6,8,10-11,14,16,26-27,29H,3-4,7,9,12H2,1-2H3/t14-,16-/m1/s1 |
| InChIKey | NKZVXBLXJXFAAZ-GDBMZVCRSA-N |
| XLogP | 4.95 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|