About 5-hydroxy-2-(4-hydroxyphenyl)spiro[9H-furo[2,3-h]chromene-8,2'-oxolane]-4-one
5-hydroxy-2-(4-hydroxyphenyl)spiro[9H-furo[2,3-h]chromene-8,2'-oxolane]-4-one (PubChem CID 132581667) has the molecular formula C20H16O6
and a molecular weight of 352.34 g/mol. Its IUPAC name is 5-hydroxy-2-(4-hydroxyphenyl)spiro[9H-furo[2,3-h]chromene-8,2'-oxolane]-4-one.
Molecular Properties
| Compound Name | 5-hydroxy-2-(4-hydroxyphenyl)spiro[9H-furo[2,3-h]chromene-8,2'-oxolane]-4-one |
| PubChem CID | 132581667 |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 5-hydroxy-2-(4-hydroxyphenyl)spiro[9H-furo[2,3-h]chromene-8,2'-oxolane]-4-one |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2c3c(cc(O)c12)OC1(CCCO1)C3 |
| InChI | InChI=1S/C20H16O6/c21-12-4-2-11(3-5-12)16-8-14(22)18-15(23)9-17-13(19(18)25-16)10-20(26-17)6-1-7-24-20/h2-5,8-9,21,23H,1,6-7,10H2 |
| InChIKey | GUUNJRGDVDVAAU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-hydroxy-2-(4-hydroxyphenyl)spiro[9H-furo[2,3-h]chromene-8,2'-oxolane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2-(4-hydroxyphenyl)spiro[9H-furo[2,3-h]chromene-8,2'-oxolane]-4-one?
The IUPAC name of 5-hydroxy-2-(4-hydroxyphenyl)spiro[9H-furo[2,3-h]chromene-8,2'-oxolane]-4-one (CID 132581667) is 5-hydroxy-2-(4-hydroxyphenyl)spiro[9H-furo[2,3-h]chromene-8,2'-oxolane]-4-one.
What is the SMILES notation for 5-hydroxy-2-(4-hydroxyphenyl)spiro[9H-furo[2,3-h]chromene-8,2'-oxolane]-4-one?
The canonical SMILES for 5-hydroxy-2-(4-hydroxyphenyl)spiro[9H-furo[2,3-h]chromene-8,2'-oxolane]-4-one is O=c1cc(-c2ccc(O)cc2)oc2c3c(cc(O)c12)OC1(CCCO1)C3.
What is the InChIKey of 5-hydroxy-2-(4-hydroxyphenyl)spiro[9H-furo[2,3-h]chromene-8,2'-oxolane]-4-one?
The InChIKey is GUUNJRGDVDVAAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16O6/c21-12-4-2-11(3-5-12)16-8-14(22)18-15(23)9-17-13(19(18)25-16)10-20(26-17)6-1-7-24-20/h2-5,8-9,21,23H,1,6-7,10H2.
What are the key properties of 5-hydroxy-2-(4-hydroxyphenyl)spiro[9H-furo[2,3-h]chromene-8,2'-oxolane]-4-one?
5-hydroxy-2-(4-hydroxyphenyl)spiro[9H-furo[2,3-h]chromene-8,2'-oxolane]-4-one has a molecular weight of 352.34 g/mol, XLogP of 3.31, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2-(4-hydroxyphenyl)spiro[9H-furo[2,3-h]chromene-8,2'-oxolane]-4-one is sourced from PubChem (CID 132581667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).