C25H40O5 — CID 163051173
[(2S)-2-acetyloxy-3-hydroxypropyl] (1S,4bS,9S)-2,4b,8,8,9-pentamethyl-1,2,4a,5,6,7,8a,9,10,10a-decahydrophenanthrene-1-carboxylate (PubChem CID 163051173) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is [(2S)-2-acetyloxy-3-hydroxypropyl] (1S,4bS,9S)-2,4b,8,8,9-pentamethyl-1,2,4a,5,6,7,8a,9,10,10a-decahydrophenanthrene-1-carboxylate.
| Compound Name | [(2S)-2-acetyloxy-3-hydroxypropyl] (1S,4bS,9S)-2,4b,8,8,9-pentamethyl-1,2,4a,5,6,7,8a,9,10,10a-decahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 163051173 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | [(2S)-2-acetyloxy-3-hydroxypropyl] (1S,4bS,9S)-2,4b,8,8,9-pentamethyl-1,2,4a,5,6,7,8a,9,10,10a-decahydrophenanthrene-1-carboxylate |
| SMILES | CC(=O)O[C@@H](CO)COC(=O)[C@H]1C(C)C=CC2C1C[C@H](C)C1C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C25H40O5/c1-15-8-9-20-19(21(15)23(28)29-14-18(13-26)30-17(3)27)12-16(2)22-24(4,5)10-7-11-25(20,22)6/h8-9,15-16,18-22,26H,7,10-14H2,1-6H3/t15?,16-,18-,19?,20?,21-,22?,25-/m0/s1 |
| InChIKey | RIVWTJKOFBZLMB-KRUPMZGUSA-N |
| XLogP | 4.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|