C22H32N2O8 — CID 163053633
2-hydroxy-N-[7-hydroxy-2,6-dimethyl-8-(3-methylbutyl)-4,9-dioxo-1,5-dioxonan-3-yl]-3-(hydroxymethylamino)benzamide (PubChem CID 163053633) has the molecular formula C22H32N2O8 and a molecular weight of 452.50 g/mol. Its IUPAC name is 2-hydroxy-N-[7-hydroxy-2,6-dimethyl-8-(3-methylbutyl)-4,9-dioxo-1,5-dioxonan-3-yl]-3-(hydroxymethylamino)benzamide.
| Compound Name | 2-hydroxy-N-[7-hydroxy-2,6-dimethyl-8-(3-methylbutyl)-4,9-dioxo-1,5-dioxonan-3-yl]-3-(hydroxymethylamino)benzamide |
|---|---|
| PubChem CID | 163053633 |
| Molecular Formula | C22H32N2O8 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 2-hydroxy-N-[7-hydroxy-2,6-dimethyl-8-(3-methylbutyl)-4,9-dioxo-1,5-dioxonan-3-yl]-3-(hydroxymethylamino)benzamide |
| SMILES | CC(C)CCC1C(=O)OC(C)C(NC(=O)c2cccc(NCO)c2O)C(=O)OC(C)C1O |
| InChI | InChI=1S/C22H32N2O8/c1-11(2)8-9-15-18(26)13(4)32-22(30)17(12(3)31-21(15)29)24-20(28)14-6-5-7-16(19(14)27)23-10-25/h5-7,11-13,15,17-18,23,25-27H,8-10H2,1-4H3,(H,24,28) |
| InChIKey | ITXMHVRDBRPQBN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|