C33H43N3O9 — CID 59040272
N-[3-[[(2R,6S,7R,8R)-8-butyl-2,6-dimethyl-7-(4-methyl-2-oxopentyl)-4,9-dioxo-1,5-dioxonan-3-yl]carbamoyl]-2-hydroxyphenyl]-3-hydroxy-4-methylpyridine-2-carboxamide (PubChem CID 59040272) has the molecular formula C33H43N3O9 and a molecular weight of 625.72 g/mol. Its IUPAC name is N-[3-[[(2R,6S,7R,8R)-8-butyl-2,6-dimethyl-7-(4-methyl-2-oxopentyl)-4,9-dioxo-1,5-dioxonan-3-yl]carbamoyl]-2-hydroxyphenyl]-3-hydroxy-4-methylpyridine-2-carboxamide.
| Compound Name | N-[3-[[(2R,6S,7R,8R)-8-butyl-2,6-dimethyl-7-(4-methyl-2-oxopentyl)-4,9-dioxo-1,5-dioxonan-3-yl]carbamoyl]-2-hydroxyphenyl]-3-hydroxy-4-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 59040272 |
| Molecular Formula | C33H43N3O9 |
| Molecular Weight | 625.72 g/mol |
| Exact Mass | 625.30 |
| IUPAC Name | N-[3-[[(2R,6S,7R,8R)-8-butyl-2,6-dimethyl-7-(4-methyl-2-oxopentyl)-4,9-dioxo-1,5-dioxonan-3-yl]carbamoyl]-2-hydroxyphenyl]-3-hydroxy-4-methylpyridine-2-carboxamide |
| SMILES | CCCC[C@H]1C(=O)O[C@H](C)C(NC(=O)c2cccc(NC(=O)c3nccc(C)c3O)c2O)C(=O)O[C@@H](C)[C@@H]1CC(=O)CC(C)C |
| InChI | InChI=1S/C33H43N3O9/c1-7-8-10-22-24(16-21(37)15-17(2)3)19(5)44-33(43)26(20(6)45-32(22)42)36-30(40)23-11-9-12-25(29(23)39)35-31(41)27-28(38)18(4)13-14-34-27/h9,11-14,17,19-20,22,24,26,38-39H,7-8,10,15-16H2,1-6H3,(H,35,41)(H,36,40)/t19-,20+,22+,24-,26?/m0/s1 |
| InChIKey | JEGUBEJLWYJSEC-VXYBJDFCSA-N |
| XLogP | 4.46 |
| TPSA | 181.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.72 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|