C32H41N3O11 — CID 18682170
[8-butyl-3-[[2-hydroxy-3-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]benzoyl]amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate (PubChem CID 18682170) has the molecular formula C32H41N3O11 and a molecular weight of 643.69 g/mol. Its IUPAC name is [8-butyl-3-[[2-hydroxy-3-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]benzoyl]amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate.
| Compound Name | [8-butyl-3-[[2-hydroxy-3-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]benzoyl]amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 18682170 |
| Molecular Formula | C32H41N3O11 |
| Molecular Weight | 643.69 g/mol |
| Exact Mass | 643.27 |
| IUPAC Name | [8-butyl-3-[[2-hydroxy-3-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]benzoyl]amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate |
| SMILES | CCCCC1C(=O)OC(C)C(NC(=O)c2cccc(NC(=O)c3nccc(OC)c3O)c2O)C(=O)OC(C)C1OC(=O)CC(C)C |
| InChI | InChI=1S/C32H41N3O11/c1-7-8-10-20-28(46-23(36)15-16(2)3)18(5)45-32(42)24(17(4)44-31(20)41)35-29(39)19-11-9-12-21(26(19)37)34-30(40)25-27(38)22(43-6)13-14-33-25/h9,11-14,16-18,20,24,28,37-38H,7-8,10,15H2,1-6H3,(H,34,40)(H,35,39) |
| InChIKey | LHXGXJBZYASWJS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 199.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.69 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|