C23H35N9O7 — CID 163055164
(2R)-2-[[(2R)-2-[[(2S,5R,6Z)-2,5-diamino-6-[(3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-ylidene]hexanoyl]amino]-3-methylbutanoyl]amino]propanoic acid (PubChem CID 163055164) has the molecular formula C23H35N9O7 and a molecular weight of 549.59 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-[[(2S,5R,6Z)-2,5-diamino-6-[(3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-ylidene]hexanoyl]amino]-3-methylbutanoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[(2R)-2-[[(2S,5R,6Z)-2,5-diamino-6-[(3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-ylidene]hexanoyl]amino]-3-methylbutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 163055164 |
| Molecular Formula | C23H35N9O7 |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | (2R)-2-[[(2R)-2-[[(2S,5R,6Z)-2,5-diamino-6-[(3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-ylidene]hexanoyl]amino]-3-methylbutanoyl]amino]propanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)[C@@H](N)CC[C@@H](N)/C=C1\O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)C(=O)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C23H35N9O7/c1-9(2)14(21(36)30-10(3)23(37)38)31-20(35)12(25)5-4-11(24)6-13-16(33)17(34)22(39-13)32-8-29-15-18(26)27-7-28-19(15)32/h6-12,14,16-17,22,33-34H,4-5,24-25H2,1-3H3,(H,30,36)(H,31,35)(H,37,38)(H2,26,27,28)/b13-6-/t10-,11-,12+,14-,16-,17-,22-/m1/s1 |
| InChIKey | VKJMLZRNGDFNMT-FRJFNNKNSA-N |
| XLogP | -2.29 |
| TPSA | 266.85 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |