C27H25N3O6 — CID 163059562
6-acetyl-2-[1-[2-(1H-benzimidazol-2-yl)ethylamino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 163059562) has the molecular formula C27H25N3O6 and a molecular weight of 487.51 g/mol. Its IUPAC name is 6-acetyl-2-[1-[2-(1H-benzimidazol-2-yl)ethylamino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | 6-acetyl-2-[1-[2-(1H-benzimidazol-2-yl)ethylamino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 163059562 |
| Molecular Formula | C27H25N3O6 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 6-acetyl-2-[1-[2-(1H-benzimidazol-2-yl)ethylamino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)NCCc3nc4ccccc4[nH]3)C(=O)C12C |
| InChI | InChI=1S/C27H25N3O6/c1-12-23(33)21(14(3)31)25-22(24(12)34)27(4)18(36-25)11-17(32)20(26(27)35)13(2)28-10-9-19-29-15-7-5-6-8-16(15)30-19/h5-8,11,28,33-34H,9-10H2,1-4H3,(H,29,30) |
| InChIKey | RECOXTMKTLSCNR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|