C33H35N3O6 — CID 171135417
(9bR)-6-acetyl-2-[1-[[1-(1H-benzimidazol-2-ylmethyl)cyclohexyl]methylamino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 171135417) has the molecular formula C33H35N3O6 and a molecular weight of 569.66 g/mol. Its IUPAC name is (9bR)-6-acetyl-2-[1-[[1-(1H-benzimidazol-2-ylmethyl)cyclohexyl]methylamino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | (9bR)-6-acetyl-2-[1-[[1-(1H-benzimidazol-2-ylmethyl)cyclohexyl]methylamino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 171135417 |
| Molecular Formula | C33H35N3O6 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | (9bR)-6-acetyl-2-[1-[[1-(1H-benzimidazol-2-ylmethyl)cyclohexyl]methylamino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)NCC3(Cc4nc5ccccc5[nH]4)CCCCC3)C(=O)[C@@]12C |
| InChI | InChI=1S/C33H35N3O6/c1-17-28(39)26(19(3)37)30-27(29(17)40)32(4)23(42-30)14-22(38)25(31(32)41)18(2)34-16-33(12-8-5-9-13-33)15-24-35-20-10-6-7-11-21(20)36-24/h6-7,10-11,14,34,39-40H,5,8-9,12-13,15-16H2,1-4H3,(H,35,36)/t32-/m0/s1 |
| InChIKey | LQXFHRCJTTYMMX-YTTGMZPUSA-N |
| XLogP | 5.23 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|