About [4-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]phenyl] (E)-2-methylbut-2-enoate
[4-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]phenyl] (E)-2-methylbut-2-enoate (PubChem CID 163088797) has the molecular formula C15H18O4
and a molecular weight of 262.31 g/mol. Its IUPAC name is [4-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]phenyl] (E)-2-methylbut-2-enoate.
Molecular Properties
| Compound Name | [4-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]phenyl] (E)-2-methylbut-2-enoate |
| PubChem CID | 163088797 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | [4-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]phenyl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)Oc1ccc(OC)cc1[C@H]1O[C@H]1C |
| InChI | InChI=1S/C15H18O4/c1-5-9(2)15(16)19-13-7-6-11(17-4)8-12(13)14-10(3)18-14/h5-8,10,14H,1-4H3/b9-5+/t10-,14-/m0/s1 |
| InChIKey | SRKAZFSLCLSHPY-ZICUJGQLSA-N |
| XLogP | 3.03 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [4-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]phenyl] (E)-2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]phenyl] (E)-2-methylbut-2-enoate?
The IUPAC name of [4-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]phenyl] (E)-2-methylbut-2-enoate (CID 163088797) is [4-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]phenyl] (E)-2-methylbut-2-enoate.
What is the SMILES notation for [4-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]phenyl] (E)-2-methylbut-2-enoate?
The canonical SMILES for [4-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]phenyl] (E)-2-methylbut-2-enoate is C/C=C(\C)C(=O)Oc1ccc(OC)cc1[C@H]1O[C@H]1C.
What is the InChIKey of [4-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]phenyl] (E)-2-methylbut-2-enoate?
The InChIKey is SRKAZFSLCLSHPY-ZICUJGQLSA-N. The full InChI is InChI=1S/C15H18O4/c1-5-9(2)15(16)19-13-7-6-11(17-4)8-12(13)14-10(3)18-14/h5-8,10,14H,1-4H3/b9-5+/t10-,14-/m0/s1.
What are the key properties of [4-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]phenyl] (E)-2-methylbut-2-enoate?
[4-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]phenyl] (E)-2-methylbut-2-enoate has a molecular weight of 262.31 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methoxy-2-[(2R,3S)-3-methyloxiran-2-yl]phenyl] (E)-2-methylbut-2-enoate is sourced from PubChem (CID 163088797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).