C18H16Br2N2O4 — CID 163118945
4-[(1R,2R)-1,2-dibromo-2-naphthalen-1-ylethyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide (PubChem CID 163118945) has the molecular formula C18H16Br2N2O4 and a molecular weight of 484.14 g/mol. Its IUPAC name is 4-[(1R,2R)-1,2-dibromo-2-naphthalen-1-ylethyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide.
| Compound Name | 4-[(1R,2R)-1,2-dibromo-2-naphthalen-1-ylethyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 163118945 |
| Molecular Formula | C18H16Br2N2O4 |
| Molecular Weight | 484.14 g/mol |
| Exact Mass | 481.95 |
| IUPAC Name | 4-[(1R,2R)-1,2-dibromo-2-naphthalen-1-ylethyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
| SMILES | [O-][NH+](O)c1ccc([C@@H](Br)[C@H](Br)c2cccc3ccccc23)c([NH+]([O-])O)c1 |
| InChI | InChI=1S/C18H16Br2N2O4/c19-17(14-7-3-5-11-4-1-2-6-13(11)14)18(20)15-9-8-12(21(23)24)10-16(15)22(25)26/h1-10,17-18,21-23,25H/t17-,18-/m1/s1 |
| InChIKey | AUTWLVANYGSCFW-QZTJIDSGSA-N |
| XLogP | 3.22 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.14 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|