C16H19NO4 — CID 163121436
N-hydroxy-3-[(1'R,4'S)-spiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene]-2-yl]benzeneamine oxide (PubChem CID 163121436) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-hydroxy-3-[(1'R,4'S)-spiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene]-2-yl]benzeneamine oxide.
| Compound Name | N-hydroxy-3-[(1'R,4'S)-spiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene]-2-yl]benzeneamine oxide |
|---|---|
| PubChem CID | 163121436 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-hydroxy-3-[(1'R,4'S)-spiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene]-2-yl]benzeneamine oxide |
| SMILES | [O-][NH+](O)c1cccc(C2OCC3(CO2)C[C@@H]2C=C[C@@H]3C2)c1 |
| InChI | InChI=1S/C16H19NO4/c18-17(19)14-3-1-2-12(7-14)15-20-9-16(10-21-15)8-11-4-5-13(16)6-11/h1-5,7,11,13,15,17-18H,6,8-10H2/t11-,13-,15?,16?/m1/s1 |
| InChIKey | BQZNJCRFFSFQKP-UYSYKMHKSA-N |
| XLogP | 1.72 |
| TPSA | 66.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|