C32H50N3O5+ — CID 163130027
4-[2-[2-(7-aminoheptyl)-3-(hydroxymethyl)-2H-furan-1-ium-5-id-5-yl]ethyl]-2-[2-[4-[1-(2-hydroxypropylamino)propan-2-yl]pyrrol-4-ylium-2-yl]ethoxy]phenol (PubChem CID 163130027) has the molecular formula C32H50N3O5+ and a molecular weight of 556.77 g/mol. Its IUPAC name is 4-[2-[2-(7-aminoheptyl)-3-(hydroxymethyl)-2H-furan-1-ium-5-id-5-yl]ethyl]-2-[2-[4-[1-(2-hydroxypropylamino)propan-2-yl]pyrrol-4-ylium-2-yl]ethoxy]phenol.
| Compound Name | 4-[2-[2-(7-aminoheptyl)-3-(hydroxymethyl)-2H-furan-1-ium-5-id-5-yl]ethyl]-2-[2-[4-[1-(2-hydroxypropylamino)propan-2-yl]pyrrol-4-ylium-2-yl]ethoxy]phenol |
|---|---|
| PubChem CID | 163130027 |
| Molecular Formula | C32H50N3O5+ |
| Molecular Weight | 556.77 g/mol |
| Exact Mass | 556.37 |
| IUPAC Name | 4-[2-[2-(7-aminoheptyl)-3-(hydroxymethyl)-2H-furan-1-ium-5-id-5-yl]ethyl]-2-[2-[4-[1-(2-hydroxypropylamino)propan-2-yl]pyrrol-4-ylium-2-yl]ethoxy]phenol |
| SMILES | CC(O)CNCC(C)[C+]1C=NC(CCOc2cc(CC[C-]3C=C(CO)C(CCCCCCCN)[OH+]3)ccc2O)=C1 |
| InChI | InChI=1S/C32H49N3O5/c1-23(19-34-20-24(2)37)26-17-28(35-21-26)13-15-39-32-16-25(10-12-30(32)38)9-11-29-18-27(22-36)31(40-29)8-6-4-3-5-7-14-33/h10,12,16-18,21,23-24,31,34,36-37,40H,3-9,11,13-15,19-20,22,33H2,1-2H3/p+1 |
| InChIKey | XHLJJWFKXOYMPS-UHFFFAOYSA-O |
| XLogP | 3.90 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.77 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|