C33H49N2O5+ — CID 163158245
4-[2-[2-butyl-3-(hydroxymethyl)-2H-furan-1-ium-5-id-5-yl]ethyl]-2-[2-[4-[1-cyclopentyl-2-(2-hydroxypropylamino)ethyl]pyrrol-4-ylium-2-yl]ethoxy]phenol (PubChem CID 163158245) has the molecular formula C33H49N2O5+ and a molecular weight of 553.76 g/mol. Its IUPAC name is 4-[2-[2-butyl-3-(hydroxymethyl)-2H-furan-1-ium-5-id-5-yl]ethyl]-2-[2-[4-[1-cyclopentyl-2-(2-hydroxypropylamino)ethyl]pyrrol-4-ylium-2-yl]ethoxy]phenol.
| Compound Name | 4-[2-[2-butyl-3-(hydroxymethyl)-2H-furan-1-ium-5-id-5-yl]ethyl]-2-[2-[4-[1-cyclopentyl-2-(2-hydroxypropylamino)ethyl]pyrrol-4-ylium-2-yl]ethoxy]phenol |
|---|---|
| PubChem CID | 163158245 |
| Molecular Formula | C33H49N2O5+ |
| Molecular Weight | 553.76 g/mol |
| Exact Mass | 553.36 |
| IUPAC Name | 4-[2-[2-butyl-3-(hydroxymethyl)-2H-furan-1-ium-5-id-5-yl]ethyl]-2-[2-[4-[1-cyclopentyl-2-(2-hydroxypropylamino)ethyl]pyrrol-4-ylium-2-yl]ethoxy]phenol |
| SMILES | CCCCC1[OH+][C-](CCc2ccc(O)c(OCCC3=C[C+](C(CNCC(C)O)C4CCCC4)C=N3)c2)C=C1CO |
| InChI | InChI=1S/C33H48N2O5/c1-3-4-9-32-27(22-36)18-29(40-32)12-10-24-11-13-31(38)33(16-24)39-15-14-28-17-26(20-35-28)30(21-34-19-23(2)37)25-7-5-6-8-25/h11,13,16-18,20,23,25,30,32,34,36-37,40H,3-10,12,14-15,19,21-22H2,1-2H3/p+1 |
| InChIKey | SPIVQIPIEDVQCI-UHFFFAOYSA-O |
| XLogP | 4.96 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.76 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|