C32H47N2O4+ — CID 163177614
4-[2-(2-butyl-2H-furan-1-ium-5-id-5-yl)ethyl]-2-[2-[4-[(1S)-1-cyclopentyl-2-[[(2S)-2-hydroxypropyl]amino]ethyl]pyrrol-4-ylium-2-yl]ethoxy]phenol (PubChem CID 163177614) has the molecular formula C32H47N2O4+ and a molecular weight of 523.74 g/mol. Its IUPAC name is 4-[2-(2-butyl-2H-furan-1-ium-5-id-5-yl)ethyl]-2-[2-[4-[(1S)-1-cyclopentyl-2-[[(2S)-2-hydroxypropyl]amino]ethyl]pyrrol-4-ylium-2-yl]ethoxy]phenol.
| Compound Name | 4-[2-(2-butyl-2H-furan-1-ium-5-id-5-yl)ethyl]-2-[2-[4-[(1S)-1-cyclopentyl-2-[[(2S)-2-hydroxypropyl]amino]ethyl]pyrrol-4-ylium-2-yl]ethoxy]phenol |
|---|---|
| PubChem CID | 163177614 |
| Molecular Formula | C32H47N2O4+ |
| Molecular Weight | 523.74 g/mol |
| Exact Mass | 523.35 |
| IUPAC Name | 4-[2-(2-butyl-2H-furan-1-ium-5-id-5-yl)ethyl]-2-[2-[4-[(1S)-1-cyclopentyl-2-[[(2S)-2-hydroxypropyl]amino]ethyl]pyrrol-4-ylium-2-yl]ethoxy]phenol |
| SMILES | CCCCC1C=C[C-](CCc2ccc(O)c(OCCC3=C[C+]([C@H](CNC[C@H](C)O)C4CCCC4)C=N3)c2)[OH+]1 |
| InChI | InChI=1S/C32H46N2O4/c1-3-4-9-28-13-14-29(38-28)12-10-24-11-15-31(36)32(18-24)37-17-16-27-19-26(21-34-27)30(22-33-20-23(2)35)25-7-5-6-8-25/h11,13-15,18-19,21,23,25,28,30,33,35,38H,3-10,12,16-17,20,22H2,1-2H3/p+1/t23-,28?,30+/m0/s1 |
| InChIKey | CXQKKBGLJHAZAV-YEDWXZNVSA-O |
| XLogP | 5.60 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.74 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|