C33H48NO5+ — CID 163159553
(2S,3S,6S)-6-[5-[2-[5-[2-(2-butyl-2H-furan-1-ium-5-id-5-yl)ethyl]-2-hydroxyphenoxy]ethyl]pyrrol-3-ylium-3-yl]-6-cyclopentylhexane-2,3-diol (PubChem CID 163159553) has the molecular formula C33H48NO5+ and a molecular weight of 538.75 g/mol. Its IUPAC name is (2S,3S,6S)-6-[5-[2-[5-[2-(2-butyl-2H-furan-1-ium-5-id-5-yl)ethyl]-2-hydroxyphenoxy]ethyl]pyrrol-3-ylium-3-yl]-6-cyclopentylhexane-2,3-diol.
| Compound Name | (2S,3S,6S)-6-[5-[2-[5-[2-(2-butyl-2H-furan-1-ium-5-id-5-yl)ethyl]-2-hydroxyphenoxy]ethyl]pyrrol-3-ylium-3-yl]-6-cyclopentylhexane-2,3-diol |
|---|---|
| PubChem CID | 163159553 |
| Molecular Formula | C33H48NO5+ |
| Molecular Weight | 538.75 g/mol |
| Exact Mass | 538.35 |
| IUPAC Name | (2S,3S,6S)-6-[5-[2-[5-[2-(2-butyl-2H-furan-1-ium-5-id-5-yl)ethyl]-2-hydroxyphenoxy]ethyl]pyrrol-3-ylium-3-yl]-6-cyclopentylhexane-2,3-diol |
| SMILES | CCCCC1C=C[C-](CCc2ccc(O)c(OCCC3=C[C+]([C@H](CC[C@H](O)[C@H](C)O)C4CCCC4)C=N3)c2)[OH+]1 |
| InChI | InChI=1S/C33H47NO5/c1-3-4-9-28-13-14-29(39-28)12-10-24-11-16-32(37)33(20-24)38-19-18-27-21-26(22-34-27)30(25-7-5-6-8-25)15-17-31(36)23(2)35/h11,13-14,16,20-23,25,28,30-31,35-36,39H,3-10,12,15,17-19H2,1-2H3/p+1/t23-,28?,30+,31-/m0/s1 |
| InChIKey | WRIBWQVNHNAQRF-UZWMNVROSA-O |
| XLogP | 6.15 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.75 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|