C29H42NO6+ — CID 163166584
6-[5-[2-[5-[2-(2-butyl-2H-furan-1-ium-5-id-5-yl)ethyl]-2-hydroxyphenoxy]-1-hydroxyethyl]pyrrol-3-ylium-3-yl]heptane-2,3-diol (PubChem CID 163166584) has the molecular formula C29H42NO6+ and a molecular weight of 500.66 g/mol. Its IUPAC name is 6-[5-[2-[5-[2-(2-butyl-2H-furan-1-ium-5-id-5-yl)ethyl]-2-hydroxyphenoxy]-1-hydroxyethyl]pyrrol-3-ylium-3-yl]heptane-2,3-diol.
| Compound Name | 6-[5-[2-[5-[2-(2-butyl-2H-furan-1-ium-5-id-5-yl)ethyl]-2-hydroxyphenoxy]-1-hydroxyethyl]pyrrol-3-ylium-3-yl]heptane-2,3-diol |
|---|---|
| PubChem CID | 163166584 |
| Molecular Formula | C29H42NO6+ |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | 6-[5-[2-[5-[2-(2-butyl-2H-furan-1-ium-5-id-5-yl)ethyl]-2-hydroxyphenoxy]-1-hydroxyethyl]pyrrol-3-ylium-3-yl]heptane-2,3-diol |
| SMILES | CCCCC1C=C[C-](CCc2ccc(O)c(OCC(O)C3=C[C+](C(C)CCC(O)C(C)O)C=N3)c2)[OH+]1 |
| InChI | InChI=1S/C29H41NO6/c1-4-5-6-23-11-12-24(36-23)10-8-21-9-14-27(33)29(15-21)35-18-28(34)25-16-22(17-30-25)19(2)7-13-26(32)20(3)31/h9,11-12,14-17,19-20,23,26,28,31-32,34,36H,4-8,10,13,18H2,1-3H3/p+1 |
| InChIKey | NCGDKFULRNWWSF-UHFFFAOYSA-O |
| XLogP | 3.95 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|