C28H41N2O4+ — CID 163179287
4-[2-(2-butyl-2H-furan-1-ium-5-id-5-yl)ethyl]-2-[2-[4-[(2S)-1-[[(2S)-2-hydroxypropyl]amino]propan-2-yl]pyrrol-4-ylium-2-yl]ethoxy]phenol (PubChem CID 163179287) has the molecular formula C28H41N2O4+ and a molecular weight of 469.65 g/mol. Its IUPAC name is 4-[2-(2-butyl-2H-furan-1-ium-5-id-5-yl)ethyl]-2-[2-[4-[(2S)-1-[[(2S)-2-hydroxypropyl]amino]propan-2-yl]pyrrol-4-ylium-2-yl]ethoxy]phenol.
| Compound Name | 4-[2-(2-butyl-2H-furan-1-ium-5-id-5-yl)ethyl]-2-[2-[4-[(2S)-1-[[(2S)-2-hydroxypropyl]amino]propan-2-yl]pyrrol-4-ylium-2-yl]ethoxy]phenol |
|---|---|
| PubChem CID | 163179287 |
| Molecular Formula | C28H41N2O4+ |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.31 |
| IUPAC Name | 4-[2-(2-butyl-2H-furan-1-ium-5-id-5-yl)ethyl]-2-[2-[4-[(2S)-1-[[(2S)-2-hydroxypropyl]amino]propan-2-yl]pyrrol-4-ylium-2-yl]ethoxy]phenol |
| SMILES | CCCCC1C=C[C-](CCc2ccc(O)c(OCCC3=C[C+]([C@H](C)CNC[C@H](C)O)C=N3)c2)[OH+]1 |
| InChI | InChI=1S/C28H40N2O4/c1-4-5-6-25-10-11-26(34-25)9-7-22-8-12-27(32)28(15-22)33-14-13-24-16-23(19-30-24)20(2)17-29-18-21(3)31/h8,10-12,15-16,19-21,25,29,31,34H,4-7,9,13-14,17-18H2,1-3H3/p+1/t20-,21+,25?/m1/s1 |
| InChIKey | VSGGUMPNEQQKEE-GJAAFAAWSA-O |
| XLogP | 4.43 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|