C9H12N2O5 — CID 163139270
(2S)-2-amino-3-[3-(dihydroxyamino)-4-hydroxyphenyl]propanoic acid (PubChem CID 163139270) has the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. Its IUPAC name is (2S)-2-amino-3-[3-(dihydroxyamino)-4-hydroxyphenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[3-(dihydroxyamino)-4-hydroxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 163139270 |
| Molecular Formula | C9H12N2O5 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | (2S)-2-amino-3-[3-(dihydroxyamino)-4-hydroxyphenyl]propanoic acid |
| SMILES | N[C@@H](Cc1ccc(O)c(N(O)O)c1)C(=O)O |
| InChI | InChI=1S/C9H12N2O5/c10-6(9(13)14)3-5-1-2-8(12)7(4-5)11(15)16/h1-2,4,6,12,15-16H,3,10H2,(H,13,14)/t6-/m0/s1 |
| InChIKey | JDTQNZBGXKTVGW-LURJTMIESA-N |
| XLogP | -0.07 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|