C11H18NO9P — CID 163144822
[(2R,3S,4R,5R)-5-(3-carboxy-1,2,3,6-tetrahydropyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 163144822) has the molecular formula C11H18NO9P and a molecular weight of 339.24 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(3-carboxy-1,2,3,6-tetrahydropyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(3-carboxy-1,2,3,6-tetrahydropyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 163144822 |
| Molecular Formula | C11H18NO9P |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(3-carboxy-1,2,3,6-tetrahydropyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | O=C(O)C1C=CC[NH+]([C@@H]2O[C@H](COP(=O)([O-])O)[C@@H](O)[C@H]2O)C1 |
| InChI | InChI=1S/C11H18NO9P/c13-8-7(5-20-22(17,18)19)21-10(9(8)14)12-3-1-2-6(4-12)11(15)16/h1-2,6-10,13-14H,3-5H2,(H,15,16)(H2,17,18,19)/t6?,7-,8-,9-,10-/m1/s1 |
| InChIKey | LDPQBBVLVLEPSE-BHRXDNSCSA-N |
| XLogP | -3.93 |
| TPSA | 161.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|