C8H12N2O7P- — CID 24971459
[(2R,3S,4R,5R)-3,4-dihydroxy-5-imidazol-1-yloxolan-2-yl]methyl hydrogen phosphate (PubChem CID 24971459) has the molecular formula C8H12N2O7P- and a molecular weight of 279.17 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-imidazol-1-yloxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-imidazol-1-yloxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 24971459 |
| Molecular Formula | C8H12N2O7P- |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-imidazol-1-yloxolan-2-yl]methyl hydrogen phosphate |
| SMILES | O=P([O-])(O)OC[C@H]1O[C@@H](n2ccnc2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H13N2O7P/c11-6-5(3-16-18(13,14)15)17-8(7(6)12)10-2-1-9-4-10/h1-2,4-8,11-12H,3H2,(H2,13,14,15)/p-1/t5-,6-,7-,8-/m1/s1 |
| InChIKey | YEBULYOZZUNFGU-WCTZXXKLSA-M |
| XLogP | -2.02 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|