C18H16O5 — CID 163152779
6-hexa-2,4-dienoyl-7-hydroxy-2-methoxy-8-methylnaphthalene-1,4-dione (PubChem CID 163152779) has the molecular formula C18H16O5 and a molecular weight of 312.32 g/mol. Its IUPAC name is 6-hexa-2,4-dienoyl-7-hydroxy-2-methoxy-8-methylnaphthalene-1,4-dione.
| Compound Name | 6-hexa-2,4-dienoyl-7-hydroxy-2-methoxy-8-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 163152779 |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 6-hexa-2,4-dienoyl-7-hydroxy-2-methoxy-8-methylnaphthalene-1,4-dione |
| SMILES | CC=CC=CC(=O)c1cc2c(c(C)c1O)C(=O)C(OC)=CC2=O |
| InChI | InChI=1S/C18H16O5/c1-4-5-6-7-13(19)12-8-11-14(20)9-15(23-3)18(22)16(11)10(2)17(12)21/h4-9,21H,1-3H3 |
| InChIKey | NZIFVIRHOWRQJX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|