C25H34O7 — CID 163153687
[2-(7,8-dihydroxy-4,8-dimethylnon-3-enyl)-8-formyl-5-hydroxy-2-methylchromen-7-yl]methyl acetate (PubChem CID 163153687) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is [2-(7,8-dihydroxy-4,8-dimethylnon-3-enyl)-8-formyl-5-hydroxy-2-methylchromen-7-yl]methyl acetate.
| Compound Name | [2-(7,8-dihydroxy-4,8-dimethylnon-3-enyl)-8-formyl-5-hydroxy-2-methylchromen-7-yl]methyl acetate |
|---|---|
| PubChem CID | 163153687 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | [2-(7,8-dihydroxy-4,8-dimethylnon-3-enyl)-8-formyl-5-hydroxy-2-methylchromen-7-yl]methyl acetate |
| SMILES | CC(=O)OCc1cc(O)c2c(c1C=O)OC(C)(CCC=C(C)CCC(O)C(C)(C)O)C=C2 |
| InChI | InChI=1S/C25H34O7/c1-16(8-9-22(29)24(3,4)30)7-6-11-25(5)12-10-19-21(28)13-18(15-31-17(2)27)20(14-26)23(19)32-25/h7,10,12-14,22,28-30H,6,8-9,11,15H2,1-5H3 |
| InChIKey | OHUGKIOTCJZLCB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|